On Target IKKB_HUMAN 0.375/CHEMBL504261
For the given ligand Mesalazine, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL504261. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL504261 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | NC(=O)c1ccc(cc1)c2ccnc3[nH]ccc23 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00002002 00000800 00004100 40050600 000c0000 00004000 00000000 00001000 00000100 00000840 01000004 60008000 80008800 00c00000 00000040 000c0004 00020000 02000004 04200000 10000002 40000000 08028620 30800000 8040000c 00000000 80000000 00000000 00000040 00404000 00460000 c0040200 000004a0 |