On Target IKKB_HUMAN 0.32407406/CHEMBL3318321
For the given ligand Ketamine, we have found in our database that, being scored 0.32407406, the most similar ligand is CHEMBL3318321. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3318321 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | O[C@H]1CCC(=O)c2c(O)cccc12 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00050000 4b000808 20000102 00010200 00080000 4002c000 02000000 00000201 00000900 00080840 08100000 40009840 04008002 00200000 00000000 00082008 00000200 02000000 00402000 00020201 00400500 08020360 01004000 00400014 00000000 80000201 00000000 00000000 00000002 00024002 c0000000 00400400 |