On Target MK03_HUMAN 0.30769232/CHEMBL3798109
For the given ligand Mesalazine, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL3798109. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL3798109 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | O=C(NCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00002002 00808808 a0004100 40010600 01040000 00000002 02400000 02001000 00000100 00000840 00200004 60008000 80008812 00400000 00000400 000c200c 00222000 02000004 04600000 10220200 c0000000 0c068608 30800800 0060400c 00100000 c0000000 10020000 80000060 00004104 00060001 80040400 00004220 |