On Target NMDZ1_HUMAN 0.3464567/CHEMBL419399
For the given ligand Tramadol, we have found in our database that, being scored 0.3464567, the most similar ligand is CHEMBL419399. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL419399 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | Cc1ccc(CC2CCN(CC#Cc3ccc4[nH]c(O)nc4c3)CC2)cc1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000202 01020810 00120902 040d0600 00442040 00004000 00000000 20100020 00100900 000808c0 09308004 50018800 00000002 00600000 60100140 000c000c 00000000 02000024 00200000 00000201 40020100 18900020 21890001 02500010 00000084 80000000 00000240 10000000 03400000 00460002 40000020 040006a0 |