Created at: Last updated at: Current status:
|
Name | Amitriptyline |
2D and 3D depictions | |
SMILES | CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 |
Model downloads | |
Fingerprints |
Name | Tramadol |
2D and 3D depictions | |
SMILES | COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 |
Model downloads | |
Fingerprints |
Name | Ibuprofen |
2D and 3D depictions | |
SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1 |
Model downloads | |
Fingerprints |
Name | Fenbufen |
2D and 3D depictions | |
SMILES | O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 |
Model downloads | |
Fingerprints |
Name | Diclofenac |
2D and 3D depictions | |
SMILES | O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
Model downloads | |
Fingerprints |