On Target ACES_HUMAN 0.65048546/CHEMBL1083056
For the given ligand Tramadol, we have found in our database that, being scored 0.65048546, the most similar ligand is CHEMBL1083056. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1083056 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COc1cc2CC(CC3CCN(CC3)c4ccccc4)C(O)c2cc1OC |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00004002 4b000008 2010010a 00010600 20081000 40006000 02040000 20000000 00000900 000808c0 08300004 50018800 00004002 20a01000 01020065 000a8008 00040000 02000000 08482000 00020201 40100500 18000030 21004040 00500010 00000000 80000201 00520000 10000080 00008202 0006000a 40020000 00000600 |