On Target PDE5A_HUMAN 0.2293578/CHEMBL362755
For the given ligand Ibuprofen, we have found in our database that, being scored 0.2293578, the most similar ligand is CHEMBL362755. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL362755 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NC(C)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 04008009 00004808 20000109 00010600 00001081 80024000 52040000 02001200 00000100 00080a40 48200000 4000b000 02808802 00010000 01000401 0a082008 10000000 02008000 00000000 40020800 00000000 08028e20 03000000 00c0101c 00004000 c0002000 08120000 80800000 00010300 00060003 e0044004 00000600 |