On Target COMT_HUMAN 0.23157895/CHEMBL1324
For the given ligand Ibuprofen, we have found in our database that, being scored 0.23157895, the most similar ligand is CHEMBL1324. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL1324 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | Cc1ccc(cc1)C(=O)c2cc(O)c(O)c(c2)[N+](=O)[O-] |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 08000002 c2000818 20001101 40010200 00000000 00000000 02002000 01000000 14400100 00080860 0c000004 40008800 00018202 00000000 20100140 3000c018 00000000 02000000 00000000 00020600 40020000 08020200 20000000 00421414 00040000 e0000000 00120000 4000a000 80400080 00060002 80000000 24000400 |