On Target COMT_HUMAN 0.32575756/CHEMBL3425731
For the given ligand Tramadol, we have found in our database that, being scored 0.32575756, the most similar ligand is CHEMBL3425731. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3425731 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | CCCCc1ccc(cc1)N2C=C(O)C(=O)C=C2CO |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000002 01000a08 60004102 50010600 00040028 00004004 04800000 00201000 02100b00 800808c0 08100004 40018000 80008804 00600200 00020040 020c000c 00008000 02804004 00200000 00060001 40000100 18008030 20800002 81500014 02002400 c0000040 00420060 00040000 04000004 0806000a c0040000 40200400 |