On Target TRPV1_RAT 0.53061223/CHEMBL2057857
For the given ligand Tramadol, we have found in our database that, being scored 0.53061223, the most similar ligand is CHEMBL2057857. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL2057857 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COc1cc(ccc1O)C(C)C(=O)NCCCc2ccc(C)c(C)c2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 42001208 20100108 00010600 00001001 80000000 02000000 20000000 00000980 000808c0 08300000 40009800 0100c002 20200000 41000001 000c8008 00000000 02000000 00080000 00020201 00000100 18240600 01000000 81400018 00000000 80000000 00120000 10010000 04000200 0006000b 00002000 00002600 |