On Target TRPV1_RAT 0.43283582/CHEMBL1940387
For the given ligand Amitriptyline, we have found in our database that, being scored 0.43283582, the most similar ligand is CHEMBL1940387. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL1940387 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CC(C(=O)NCC=C1c2ccccc2CCc3ccccc13)c4ccc(NS(=O)(=O)C)c(F)c4 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00080002 00008800 00100102 42310600 20000000 00402012 80100480 01000401 04000980 20482840 08302004 50009000 01008402 00211001 c0080042 00020002 20000400 12000100 00100000 00804201 40100100 18300e00 20404000 81400818 00000084 a0000001 80482000 4001010d 06600080 00068003 0c002000 02010760 |