On Target FABP5_HUMAN 0.3553719/CHEMBL378857
For the given ligand Tramadol, we have found in our database that, being scored 0.3553719, the most similar ligand is CHEMBL378857. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL378857 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | O[C@H](C(=O)O)c1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04008000 4a000008 20000108 00210200 00001041 80004000 02000000 08008a00 00000100 00080840 08000000 4000d900 0380c006 20010080 41040005 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 05000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40006000 00020400 |