On Target FABP5_HUMAN 0.15846995/CHEMBL3959018
For the given ligand Amitriptyline, we have found in our database that, being scored 0.15846995, the most similar ligand is CHEMBL3959018. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL3959018 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | Clc1ccc2nc(N3CCCCC3)c(c4nnn[nH]4)c(c5ccccc5)c2c1 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 0000e002 01000819 40104100 00010e10 20041004 18062048 0400000c 00183000 00000100 200008d0 00218004 70018800 8300088e 00600000 20020040 000c200e 00060000 06004804 0c200000 00a00205 40160100 1c028108 30808800 8070c018 00042002 80680000 18040280 100010c0 0040c00c 00060800 80041200 09020220 |