On Target MK01_HUMAN 0.32038835/CHEMBL1909070
For the given ligand Amitriptyline, we have found in our database that, being scored 0.32038835, the most similar ligand is CHEMBL1909070. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL1909070 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CC(C)(Oc1ccc(cc1)C2CCCc3ccccc23)C(=O)O |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 04000000 01000008 2000010a 00010200 00001000 00000002 02040400 01000001 00000800 00080840 08140000 4000d000 00808002 00200000 01200001 00080008 00000200 82000000 00102000 00020001 00000100 08000a00 05004000 08400010 00000000 a0000001 00120008 40800000 02000282 00020002 00000000 00000400 |