On Target TRPV3_HUMAN 0.2882883/CHEMBL3828278
For the given ligand Fenbufen, we have found in our database that, being scored 0.2882883, the most similar ligand is CHEMBL3828278. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL3828278 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | O[C@H](c1ccccn1)C2(CCC2)c3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 0200800a 05000000 00004102 10010200 000c0060 00004000 05000000 00000000 00000b00 00080840 08108004 40808800 02000824 00200010 80860000 020c000c 08008000 06800000 00602008 00000001 40100100 08108120 21800002 00540010 00002800 80100000 00040040 00000080 00000006 00820002 40000000 20020500 |