On Target AOFA_HUMAN 0.47524753/CHEMBL3288291
For the given ligand Tramadol, we have found in our database that, being scored 0.47524753, the most similar ligand is CHEMBL3288291. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3288291 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | O=C1CCCc2cc(OCc3ccccc3)ccc12 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04010000 43000808 2000010b 00010200 00001000 4000c000 02040000 00000001 00000900 00080840 08100000 40009000 04808002 20210080 01000001 02080008 00000200 02000000 00082000 00020201 00400100 08020260 00004000 00c01014 00000000 80002001 00120000 00000000 00000202 00020002 c0000000 00400400 |