On Target ADRB2_HUMAN 0.31623933/CHEMBL120278
For the given ligand Amitriptyline, we have found in our database that, being scored 0.31623933, the most similar ligand is CHEMBL120278. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL120278 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | Oc1cc2CCNC(Cc3cc(I)c(I)c(I)c3)c2cc1O |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 0000100c 46000008 20100100 10010600 00000020 c0000002 02000000 02001001 00000880 00080840 08300000 40808000 00000842 02200000 00080400 00008018 00000000 02000020 00000100 00020201 00030140 18308000 0040c000 81440010 00000000 c0000001 00720000 80000000 04000100 00060002 20240000 00002700 |