On Target PPARG_HUMAN 0.5192308/CHEMBL119097
For the given ligand Tramadol, we have found in our database that, being scored 0.5192308, the most similar ligand is CHEMBL119097. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL119097 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COC(=O)C(Cc1ccc(OCCOc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1)C(=O)N |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04000000 43000208 2000010a 00010700 00001000 40200002 02040000 00000001 00002900 000808c0 08100000 40009000 1c808002 20200080 01200001 00080008 00220200 02000000 00c8200a 00020201 00000100 18000e00 05004040 08400010 00000800 80000001 00120000 00800000 00000202 0006000a 00000000 00000400 |