On Target PPARG_HUMAN 0.3809524/CHEMBL515204
For the given ligand Amitriptyline, we have found in our database that, being scored 0.3809524, the most similar ligand is CHEMBL515204. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL515204 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | OC(=O)CC1=C\C(=C/c2cccc3ccccc23)\c4ccc(F)cc14 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00080200 00040000 00900b81 02010200 60000000 00802013 810010c1 00000403 00000840 00b82840 08100300 50009008 04008000 00201000 00080006 0008000e 04000400 02100080 00600088 00100801 00100110 18000a08 0100c840 00400010 01000800 80000001 80402000 40000001 00500000 08028002 04000040 05000600 |