On Target CASP1_HUMAN 0.41758242/CHEMBL1221546
For the given ligand Fenbufen, we have found in our database that, being scored 0.41758242, the most similar ligand is CHEMBL1221546. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL1221546 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CC(C)[C@H](CC(=O)NCCC(=O)c1ccccc1)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00070000 01001a00 00100100 00010600 00000000 00000000 00000000 20000000 00200800 000808c0 08300000 4003b000 0e008002 00000000 80000000 000c0008 00000000 02000001 00c00010 00000201 00000100 18160e00 01000080 0050001c 00001001 80000000 00000000 10000000 00000002 0006000b a0004000 00802600 |