On Target CHLE_HUMAN 0.41538462/CHEMBL51931
For the given ligand Ibuprofen, we have found in our database that, being scored 0.41538462, the most similar ligand is CHEMBL51931. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL51931 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | O=C1C(=O)c2ccccc2c3ccccc13 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 08002000 00000801 00000100 00010200 00020000 00008000 00000000 00000000 04400800 00080840 08100000 40009000 01008000 00200800 60000000 00000000 00020000 02000000 04000000 00200001 00000300 08120200 10404000 00400014 10800000 80000101 00000000 00000040 00004000 00020002 80002000 00000500 |