On Target CHLE_HUMAN 0.3398058/CHEMBL2381387
For the given ligand Amitriptyline, we have found in our database that, being scored 0.3398058, the most similar ligand is CHEMBL2381387. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL2381387 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CCN(CC)Cc1cccc(c1)C(=O)\C=C\c2ccccc2 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 00000800 00000300 00010600 00000001 00800000 90000081 02001400 01800000 00b80c40 08200000 40008000 00008822 00000000 00000402 08080008 00000400 02100000 00018400 00000800 00000000 08028200 00008000 00400014 01000000 c0000000 08402000 c0000000 00400100 00060002 84040000 00000600 |