On Target TNFA_HUMAN 0.28125/CHEMBL2337619
For the given ligand Amitriptyline, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL2337619. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL2337619 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CCCCCCOC(=O)\C=C\c1cc(OC)c(O)c2c1C[C@@H]3[C@@H]4C=C(OC)C(=O)C[C@]24CCN3C |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |