On Target ACHA9_HUMAN 0.2513661/CHEMBL386114
For the given ligand Tramadol, we have found in our database that, being scored 0.2513661, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |