On Target BACE1_HUMAN 0.5841584/CHEMBL142715
For the given ligand Tramadol, we have found in our database that, being scored 0.5841584, the most similar ligand is CHEMBL142715. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL142715 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | C(CN1CCCCC1)C2CCc3cc(OCc4ccc(cc4)c5ccccc5)ccc3C2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04002000 43000008 2010010a 00050600 00001000 40004002 02040000 20000001 00100900 000808c0 08300000 50018000 00800002 20210080 01000021 02080008 00020200 02000000 04082000 10020201 00000100 18000030 10004000 00d01010 00000000 80002001 00120000 10000040 00004202 00060002 40000000 00002600 |