On Target NEP_HUMAN 0.25862068/CHEMBL81710
For the given ligand Amitriptyline, we have found in our database that, being scored 0.25862068, the most similar ligand is CHEMBL81710. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL81710 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | OC(=O)CNC(=O)C1(CS)Cc2ccccc2C1 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 01004600 00100102 00110600 00000080 00000000 01000000 20000000 00000800 000808c0 08300000 4000b000 06008002 00241000 80080000 020e0008 10000000 02000000 00000008 00400201 60000100 18000e00 02004300 00400018 00000800 80000001 00000000 10000000 00000000 0006003b 20004000 01010600 |