On Target NOS1_HUMAN 0.43333334/CHEMBL85613
For the given ligand Tramadol, we have found in our database that, being scored 0.43333334, the most similar ligand is CHEMBL85613. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL85613 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COc1ccc2N=C(N)[C@@H]3CCC[C@@H]3c2c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000002 43200208 2000010a 00010e20 00001000 40200000 13000010 00002008 00000800 000a08c3 08110004 40018000 10001002 60200008 010200c1 00000008 00000800 02000000 01082008 10020201 40000101 18010110 20000000 00400810 00090000 88100001 40040400 00000800 00080202 0186000a 000a0000 20100500 |