On Target OPRK_HUMAN 0.42592594/CHEMBL126141
For the given ligand Amitriptyline, we have found in our database that, being scored 0.42592594, the most similar ligand is CHEMBL126141. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL126141 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CCN(CC)C(=O)c1ccc(cc1)C(=C2CCN(CC=C(C)C)CC2)c3ccccc3 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 09008800 00100300 40010600 00000000 00000000 80180080 23001400 00000100 001808c8 08200000 50018800 80008802 00010000 00000402 00000000 20000400 02000140 00000000 00000201 01000000 18028600 00008000 0050001c 01000000 e0000000 00482000 d0000000 00400180 00060c03 84040000 02000600 |