On Target ALDR_HUMAN 0.35514018/CHEMBL538917
For the given ligand Amitriptyline, we have found in our database that, being scored 0.35514018, the most similar ligand is CHEMBL538917. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL538917 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | OC(=O)Cc1ccc2C(=O)c3cc(O)ccc3CCc2c1 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 42000808 20000100 40010200 00000041 00008002 02000400 01000001 04000900 00080840 08100000 40009800 01008002 00200000 40040000 20080008 08000000 02000000 00100000 00020201 00400100 08120a40 01404000 00420814 00000000 a0000001 00120000 40804004 02000080 00020002 80002000 00000500 |