On Target GRM5_HUMAN 0.5394737/CHEMBL1682795
For the given ligand Fenbufen, we have found in our database that, being scored 0.5394737, the most similar ligand is CHEMBL1682795. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL1682795 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | O=C1CCCc2cc(ccc12)C#Cc3ccccc3 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 10010200 01020800 00000902 40090200 00402001 00008000 00000000 00000001 00000900 00080840 08110000 40009800 04008000 00200000 00000000 00080008 00000200 02000000 00002000 00000011 00400100 08820240 01004001 02400014 00000004 80040001 00008000 00000000 00000002 00020002 80000000 00400400 |