On Target P2RX3_HUMAN 0.39855072/CHEMBL596234
For the given ligand Tramadol, we have found in our database that, being scored 0.39855072, the most similar ligand is CHEMBL596234. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL596234 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | OC(=O)c1cc(C(=O)O)c(cc1C(=O)O)C(=O)N(Cc2cccc(Oc3ccccc3)c2)[C@H]4CCCc5ccccc45 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000008 45801808 2010010a 50050600 00001001 0000c000 12800080 2a001001 00100900 00080cc0 c8300000 40018800 80008882 00200000 01000481 08080008 00002200 02000000 00182000 40020201 80420100 18068fa0 00004000 0054801c 00000000 c0000c01 08004000 90200000 00000382 00860003 e0040400 00000600 |