On Target AGTR2_HUMAN 0.31707317/CHEMBL290286
For the given ligand Fenbufen, we have found in our database that, being scored 0.31707317, the most similar ligand is CHEMBL290286. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL290286 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | OC(=O)[C@@H]1Cc2cc(ccc2CN1C(=O)C(c3ccccc3)c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 0000a008 00805000 00100100 10010600 000010a1 00000000 01001000 03001004 00000980 00080840 08300000 4000b000 87008882 00200000 c0080480 00080008 10020200 02001020 04400008 10000201 80020100 18208e00 13004040 81400018 00000800 e0000081 00004000 c0000041 04004180 00860003 20046000 00002600 |