On Target AGTR2_HUMAN 0.26153848/CHEMBL128416
For the given ligand Amitriptyline, we have found in our database that, being scored 0.26153848, the most similar ligand is CHEMBL128416. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL128416 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | OC(=O)C1Cc2ccccc2CN1C(=O)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00008008 00805000 00100100 10010600 000000a0 00000000 01001000 03001004 00000880 00080840 08300000 4000b000 07008882 00200000 c0080480 00080008 10000200 02000020 00400008 00000201 80020100 18208e00 03004040 81400018 00000800 e0000001 00004000 c0000000 04000180 00860003 20046000 00002600 |