On Target OPRM_MOUSE 0.33962265/CHEMBL71301
For the given ligand Fenbufen, we have found in our database that, being scored 0.33962265, the most similar ligand is CHEMBL71301. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL71301 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CCC1CN(CC2CC2)C3C(C)C1c4cc(O)ccc4C3=O |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00010000 43000a08 20100103 00010600 00000020 40008002 02000000 20000001 00000880 000808c0 08300000 5081b000 0600800a 01200000 80000020 02040008 00000200 02000000 00002000 00020201 00400100 18220250 00004000 81500014 00000000 80000001 00120000 10000000 04000002 0006000a 80024000 00402600 |