On Target PRGR_HUMAN 0.703125/CHEMBL566982
For the given ligand Fenbufen, we have found in our database that, being scored 0.703125, the most similar ligand is CHEMBL566982. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL566982 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | Cc1cccc(c1)c2ccc3C(=O)CC(C)(C)c3c2 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00002000 01000800 00000102 40010200 00000001 00008000 00000000 00000001 00000900 00080840 08100000 40009800 04008000 00201000 00000000 000a0008 00020000 02001000 04000008 10000001 00000100 08020240 11004000 00400014 00000800 80000080 00000000 00000041 00004000 00020002 80000000 00000400 |