On Target PRGR_HUMAN 0.556701/CHEMBL3120320
For the given ligand Amitriptyline, we have found in our database that, being scored 0.556701, the most similar ligand is CHEMBL3120320. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL3120320 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CS(=O)(=O)Nc1cccc(C=C2c3ccccc3CCc4ccccc24)c1 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00080002 00000000 00000102 00310200 20000004 00002002 80000480 01000401 04000800 00080840 08102104 40008000 00000400 00200001 80081042 00020002 04000400 02000000 00100000 00004003 40100100 18100800 20404000 00400810 00040080 a0000001 00402000 4000000c 02400082 00060002 04000000 00010560 |