On Target CXCR1_HUMAN 0.24752475/CHEMBL191413
For the given ligand Amitriptyline, we have found in our database that, being scored 0.24752475, the most similar ligand is CHEMBL191413. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL191413 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000040 20000000 00000100 01310600 00000000 00000000 00010000 00001000 00000900 00480840 08102000 40009800 01008001 00000001 c0000000 00000000 02000000 02000000 00000000 00004001 00000100 18000600 00000000 91400010 02000000 80000000 00000000 0000000c 04000000 00060002 00002000 00010660 |