On Target PGH2_HUMAN 0.43396226/CHEMBL226109
For the given ligand Tramadol, we have found in our database that, being scored 0.43396226, the most similar ligand is CHEMBL226109. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL226109 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COc1ccc(cc1)[C@H]2O[C@@H](CO)C[C@]2(O)c3ccc(OC)cc3 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 01000008 a000010a 00010300 00281050 00004000 02040000 00000040 00000900 01080840 08100000 40008000 00000002 02a10000 010c0001 020a9008 08000000 02000000 05402000 00020001 00010120 08100020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000500 |