On Target PGH2_HUMAN 0.5046729/CHEMBL80047
For the given ligand Amitriptyline, we have found in our database that, being scored 0.5046729, the most similar ligand is CHEMBL80047. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL80047 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CS(=O)(=O)c1ccc(cc1)C2=C(c3ccc(F)cc3)c4ccccc4C2 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00080000 00801200 00120301 02910200 00000000 00800012 80000481 01000401 00000800 00b80840 08102100 60008000 00000000 00211000 80280002 00000000 04000400 02100080 40100000 00102801 80100100 18140000 00c0c000 08400019 01000000 a0000001 00402000 40000021 02400080 00028002 04000000 00010720 |