On Target TRY1_HUMAN 0.44444445/CHEMBL102081
For the given ligand Ibuprofen, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL102081. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL102081 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | O=C1O[C@H]2CCC[C@@H]2[C@H]1Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00050040 01000008 00000102 00010300 00080000 00000000 00000000 00000000 00000800 00080840 08100000 40009000 04008008 00a00000 00080000 00081008 00820000 02000000 00402008 00000001 00000120 08000a00 01000040 00400010 00000c00 80000000 00000000 00000000 00000202 01020002 00020000 00000400 |