On Target TRY1_HUMAN 0.47916666/CHEMBL156472
For the given ligand Tramadol, we have found in our database that, being scored 0.47916666, the most similar ligand is CHEMBL156472. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL156472 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | CNC(=O)CC(CCc1ccc(cc1)C(=N)N)c2cccc(c2)C(=N)N |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00010000 01000200 00100102 00010600 00000001 00000000 00000000 00001000 00000900 000808c3 08300000 40019800 84008808 00200000 00000000 000e0008 00000000 02000000 00402408 00000001 00000100 18008610 01000000 00500010 00000800 80000000 48000000 10000000 0000000a 0006000b 40040000 00000600 |