On Target ACE_HUMAN 0.46268657/CHEMBL80667
For the given ligand Ibuprofen, we have found in our database that, being scored 0.46268657, the most similar ligand is CHEMBL80667. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL80667 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC(=O)C(Cc1ccccc1)OC(=O)CCS |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000040 00000000 00000500 00110200 00000040 00000000 00000000 00000040 00000800 00080840 08100000 4000d000 04008000 00040000 00040000 08088008 08420000 82000000 04400008 00400001 00010120 08000a00 05000440 08400014 00000c00 80000000 00000000 00000020 00000200 00020002 00000000 03010480 |