On Target TLR4_HUMAN 0.17763157/CHEMBL4071705
For the given ligand Amitriptyline, we have found in our database that, being scored 0.17763157, the most similar ligand is CHEMBL4071705. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL4071705 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | C[C@@H](OC(=O)c1ccccc1O)[C@]2(O)CC[C@]3(O)[C@]4(O)CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4C[C@@H](OC(=O)\C=C\c6ccccc6)[C@]23C |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00040000 81000808 a0000d00 00010300 00280050 00024000 82000080 00000c02 01800100 01100848 40000200 40008000 04028002 02810000 00000406 02083008 00820c00 02000020 3341a018 00022001 00000020 28020a20 05008000 08400014 00201400 80002000 00486000 c0000420 00400200 0102000a e4020000 02000010 |