On Target OPRD_HUMAN 0.5247525/CHEMBL126884
For the given ligand Amitriptyline, we have found in our database that, being scored 0.5247525, the most similar ligand is CHEMBL126884. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL126884 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CCN(CC)C(=O)c1ccc(cc1)C(=C2CCNCC2)c3c(C)cccc3C |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00080000 09000800 00100300 40010600 02000001 00000000 80080480 03001400 00000100 001808c8 08200000 50018800 80008802 00200000 00000402 00000008 00000400 02000040 00000000 00000201 01100000 18028600 0000c000 0040001c 01000000 e0000000 00402000 d0000000 02400180 00060c03 84040000 00000600 |