On Target NTRK1_HUMAN 0.30921054/CHEMBL175321
For the given ligand Amitriptyline, we have found in our database that, being scored 0.30921054, the most similar ligand is CHEMBL175321. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL175321 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | Oc1ccc2\C(=C\3/C(=O)Nc4ccccc34)\CCc2c1 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 10084212 43008008 20100302 00110600 20000000 44000000 82000080 00020400 01800800 20580842 08380104 60009008 01028102 00311000 c0020142 0002010a 24040400 02000100 08018000 00820201 40100100 18200680 2002e021 81400011 01000000 82000200 00522010 c0019280 04408000 00060003 04002000 20010600 |