On Target OPRX_HUMAN 0.37168142/CHEMBL425225
For the given ligand Amitriptyline, we have found in our database that, being scored 0.37168142, the most similar ligand is CHEMBL425225. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL425225 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | O=C(NCCCN1CCC2(CC1)CCc3ccccc23)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 01009600 00100102 00010600 00000000 00000002 80100080 20000401 01800800 004809e0 08300000 50018000 00008002 00211000 00000002 02060000 20000400 02000100 0001a000 00800201 00000100 18080610 00004000 00500018 00000000 80000001 00482000 50010000 00400002 0006001b 04000000 02002600 |