On Target FYN_HUMAN 0.28318584/CHEMBL305660
For the given ligand Amitriptyline, we have found in our database that, being scored 0.28318584, the most similar ligand is CHEMBL305660. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL305660 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00020000 01000800 00100102 40010600 00000010 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 04008002 00290000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 18020220 01000080 00500014 00000401 a0002000 00080000 50000000 00000280 00060002 c0000000 02802600 |