On Target CAH2_HUMAN 0.6282051/CHEMBL4089410
For the given ligand Tramadol, we have found in our database that, being scored 0.6282051, the most similar ligand is CHEMBL4089410. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL4089410 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | COc1ccc(C[C@H]2C[C@H]2CO)cc1OC |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 43000008 2000010a 00010200 00081000 40000000 02040000 00000000 00000800 00080840 08100000 40008000 00004002 21a00000 01000001 00088008 00000000 02000000 00482000 00020201 00000100 08000000 01000000 00400010 00000000 80000000 00120000 00000000 00000202 0002000a 00000000 00000400 |