On Target CAH2_HUMAN 0.29473683/CHEMBL926
For the given ligand Amitriptyline, we have found in our database that, being scored 0.29473683, the most similar ligand is CHEMBL926. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL926 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | CC(CCc1ccc(O)cc1)NCCc2ccc(O)c(O)c2 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000000 43000208 20100102 00010600 00000000 80000000 02000000 20000000 00000880 000808c0 08300000 40008000 00000002 00200000 00000000 00048008 00000000 02000000 00000000 00020201 00000100 18200000 00000000 81400010 00000000 80000000 00120000 10000000 04000000 0006000a 00000000 00002600 |