On Target ESR1_HUMAN 0.5744681/CHEMBL1222035
For the given ligand Tramadol, we have found in our database that, being scored 0.5744681, the most similar ligand is CHEMBL1222035. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1222035 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | CCCCN(C)C(=O)CCCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@H]13 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00010000 43001008 20100102 00010600 00080000 40000002 02000000 20000001 00000800 000808c0 08300000 40019000 0400800a 00a00000 00000020 00080008 00000200 02000000 02402000 00020201 00000100 18040610 01004000 00500018 00000000 80000001 00120000 10000000 00000002 01060003 00020000 00002600 |